C40H25N5O2 — CID 164939355
6-anthracen-2-yl-1,3,4,5,7,8-hexadeuterio-N,N-bis[4-(1,3,4-oxadiazol-2-yl)phenyl]naphthalen-2-amine (PubChem CID 164939355) has the molecular formula C40H25N5O2 and a molecular weight of 613.71 g/mol. Its IUPAC name is 6-anthracen-2-yl-1,3,4,5,7,8-hexadeuterio-N,N-bis[4-(1,3,4-oxadiazol-2-yl)phenyl]naphthalen-2-amine.
| Compound Name | 6-anthracen-2-yl-1,3,4,5,7,8-hexadeuterio-N,N-bis[4-(1,3,4-oxadiazol-2-yl)phenyl]naphthalen-2-amine |
|---|---|
| PubChem CID | 164939355 |
| Molecular Formula | C40H25N5O2 |
| Molecular Weight | 613.71 g/mol |
| Exact Mass | 613.24 |
| IUPAC Name | 6-anthracen-2-yl-1,3,4,5,7,8-hexadeuterio-N,N-bis[4-(1,3,4-oxadiazol-2-yl)phenyl]naphthalen-2-amine |
| SMILES | [2H]c1c(N(c2ccc(-c3nnco3)cc2)c2ccc(-c3nnco3)cc2)c([2H])c2c([2H])c([2H])c(-c3ccc4cc5ccccc5cc4c3)c([2H])c2c1[2H] |
| InChI | InChI=1S/C40H25N5O2/c1-2-4-29-21-35-22-31(5-7-33(35)19-28(29)3-1)30-6-8-34-23-38(18-13-32(34)20-30)45(36-14-9-26(10-15-36)39-43-41-24-46-39)37-16-11-27(12-17-37)40-44-42-25-47-40/h1-25H/i6D,8D,13D,18D,20D,23D |
| InChIKey | SDVUVFFXJWXAES-UXOTVYTKSA-N |
| XLogP | 10.38 |
| TPSA | 81.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.71 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|