C47H28F3N3O2 — CID 164939348
N-[1,3,4,5,7,8-hexadeuterio-6-[6-(trifluoromethyl)naphthalen-2-yl]naphthalen-2-yl]-2-phenyl-N-(2-phenyl-1,3-benzoxazol-6-yl)-1,3-benzoxazol-6-amine (PubChem CID 164939348) has the molecular formula C47H28F3N3O2 and a molecular weight of 729.79 g/mol. Its IUPAC name is N-[1,3,4,5,7,8-hexadeuterio-6-[6-(trifluoromethyl)naphthalen-2-yl]naphthalen-2-yl]-2-phenyl-N-(2-phenyl-1,3-benzoxazol-6-yl)-1,3-benzoxazol-6-amine.
| Compound Name | N-[1,3,4,5,7,8-hexadeuterio-6-[6-(trifluoromethyl)naphthalen-2-yl]naphthalen-2-yl]-2-phenyl-N-(2-phenyl-1,3-benzoxazol-6-yl)-1,3-benzoxazol-6-amine |
|---|---|
| PubChem CID | 164939348 |
| Molecular Formula | C47H28F3N3O2 |
| Molecular Weight | 729.79 g/mol |
| Exact Mass | 729.25 |
| IUPAC Name | N-[1,3,4,5,7,8-hexadeuterio-6-[6-(trifluoromethyl)naphthalen-2-yl]naphthalen-2-yl]-2-phenyl-N-(2-phenyl-1,3-benzoxazol-6-yl)-1,3-benzoxazol-6-amine |
| SMILES | [2H]c1c(N(c2ccc3nc(-c4ccccc4)oc3c2)c2ccc3nc(-c4ccccc4)oc3c2)c([2H])c2c([2H])c([2H])c(-c3ccc4cc(C(F)(F)F)ccc4c3)c([2H])c2c1[2H] |
| InChI | InChI=1S/C47H28F3N3O2/c48-47(49,50)37-17-15-33-23-31(11-13-35(33)25-37)32-12-14-36-26-38(18-16-34(36)24-32)53(39-19-21-41-43(27-39)54-45(51-41)29-7-3-1-4-8-29)40-20-22-42-44(28-40)55-46(52-42)30-9-5-2-6-10-30/h1-28H/i12D,14D,16D,18D,24D,26D |
| InChIKey | LYJNHALNQWWRGT-CZNNFCDSSA-N |
| XLogP | 13.77 |
| TPSA | 55.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 729.79 |
| LogP ≤ 5 | 13.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |