C6H5I — CID 174258467
bicyclo[2.2.0]hexa-1,3,5-triene;hydroiodide (PubChem CID 174258467) has the molecular formula C6H5I and a molecular weight of 204.01 g/mol. Its IUPAC name is bicyclo[2.2.0]hexa-1,3,5-triene;hydroiodide.
| Compound Name | bicyclo[2.2.0]hexa-1,3,5-triene;hydroiodide |
|---|---|
| PubChem CID | 174258467 |
| Molecular Formula | C6H5I |
| Molecular Weight | 204.01 g/mol |
| Exact Mass | 203.94 |
| IUPAC Name | bicyclo[2.2.0]hexa-1,3,5-triene;hydroiodide |
| SMILES | I.c1cc2ccc1-2 |
| InChI | InChI=1S/C6H4.HI/c1-2-6-4-3-5(1)6;/h1-4H;1H |
| InChIKey | BAQKCANGJLYMRS-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.01 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|