About bicyclo[2.2.0]hexa-1,3,5-triene;methanol;hydroiodide
bicyclo[2.2.0]hexa-1,3,5-triene;methanol;hydroiodide (PubChem CID 174565915) has the molecular formula C7H9IO
and a molecular weight of 236.05 g/mol. Its IUPAC name is bicyclo[2.2.0]hexa-1,3,5-triene;methanol;hydroiodide.
Molecular Properties
| Compound Name | bicyclo[2.2.0]hexa-1,3,5-triene;methanol;hydroiodide |
| PubChem CID | 174565915 |
| Molecular Formula | C7H9IO |
| Molecular Weight | 236.05 g/mol |
| Exact Mass | 235.97 |
| IUPAC Name | bicyclo[2.2.0]hexa-1,3,5-triene;methanol;hydroiodide |
| SMILES | CO.I.c1cc2ccc1-2 |
| InChI | InChI=1S/C6H4.CH4O.HI/c1-2-6-4-3-5(1)6;1-2;/h1-4H;2H,1H3;1H |
| InChIKey | KEYGQVCTMJRTKR-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.05 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze bicyclo[2.2.0]hexa-1,3,5-triene;methanol;hydroiodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bicyclo[2.2.0]hexa-1,3,5-triene;methanol;hydroiodide?
The IUPAC name of bicyclo[2.2.0]hexa-1,3,5-triene;methanol;hydroiodide (CID 174565915) is bicyclo[2.2.0]hexa-1,3,5-triene;methanol;hydroiodide.
What is the SMILES notation for bicyclo[2.2.0]hexa-1,3,5-triene;methanol;hydroiodide?
The canonical SMILES for bicyclo[2.2.0]hexa-1,3,5-triene;methanol;hydroiodide is CO.I.c1cc2ccc1-2.
What is the InChIKey of bicyclo[2.2.0]hexa-1,3,5-triene;methanol;hydroiodide?
The InChIKey is KEYGQVCTMJRTKR-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H4.CH4O.HI/c1-2-6-4-3-5(1)6;1-2;/h1-4H;2H,1H3;1H.
What are the key properties of bicyclo[2.2.0]hexa-1,3,5-triene;methanol;hydroiodide?
bicyclo[2.2.0]hexa-1,3,5-triene;methanol;hydroiodide has a molecular weight of 236.05 g/mol, XLogP of 1.89, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for bicyclo[2.2.0]hexa-1,3,5-triene;methanol;hydroiodide is sourced from PubChem (CID 174565915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).