C7H9IO — CID 174565915
bicyclo[2.2.0]hexa-1,3,5-triene;methanol;hydroiodide (PubChem CID 174565915) has the molecular formula C7H9IO and a molecular weight of 236.05 g/mol. Its IUPAC name is bicyclo[2.2.0]hexa-1,3,5-triene;methanol;hydroiodide.
| Compound Name | bicyclo[2.2.0]hexa-1,3,5-triene;methanol;hydroiodide |
|---|---|
| PubChem CID | 174565915 |
| Molecular Formula | C7H9IO |
| Molecular Weight | 236.05 g/mol |
| Exact Mass | 235.97 |
| IUPAC Name | bicyclo[2.2.0]hexa-1,3,5-triene;methanol;hydroiodide |
| SMILES | CO.I.c1cc2ccc1-2 |
| InChI | InChI=1S/C6H4.CH4O.HI/c1-2-6-4-3-5(1)6;1-2;/h1-4H;2H,1H3;1H |
| InChIKey | KEYGQVCTMJRTKR-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.05 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|