About 4-(4-hydroxyphenyl)phenol;methanol
4-(4-hydroxyphenyl)phenol;methanol (PubChem CID 159599615) has the molecular formula C17H30O7
and a molecular weight of 346.42 g/mol. Its IUPAC name is 4-(4-hydroxyphenyl)phenol;methanol.
Molecular Properties
| Compound Name | 4-(4-hydroxyphenyl)phenol;methanol |
| PubChem CID | 159599615 |
| Molecular Formula | C17H30O7 |
| Molecular Weight | 346.42 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 4-(4-hydroxyphenyl)phenol;methanol |
| SMILES | CO.CO.CO.CO.CO.Oc1ccc(-c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C12H10O2.5CH4O/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;5*1-2/h1-8,13-14H;5*2H,1H3 |
| InChIKey | MLHLWNOLFKPMMZ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 141.61 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 346.42 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-(4-hydroxyphenyl)phenol;methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-hydroxyphenyl)phenol;methanol?
The IUPAC name of 4-(4-hydroxyphenyl)phenol;methanol (CID 159599615) is 4-(4-hydroxyphenyl)phenol;methanol.
What is the SMILES notation for 4-(4-hydroxyphenyl)phenol;methanol?
The canonical SMILES for 4-(4-hydroxyphenyl)phenol;methanol is CO.CO.CO.CO.CO.Oc1ccc(-c2ccc(O)cc2)cc1.
What is the InChIKey of 4-(4-hydroxyphenyl)phenol;methanol?
The InChIKey is MLHLWNOLFKPMMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O2.5CH4O/c13-11-5-1-9(2-6-11)10-3-7-12(14)8-4-10;5*1-2/h1-8,13-14H;5*2H,1H3.
What are the key properties of 4-(4-hydroxyphenyl)phenol;methanol?
4-(4-hydroxyphenyl)phenol;methanol has a molecular weight of 346.42 g/mol, XLogP of 0.81, 1 rotatable bonds, 7 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-hydroxyphenyl)phenol;methanol is sourced from PubChem (CID 159599615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).