C12H8Al2 — CID 23585944
CID 23585944 (PubChem CID 23585944) has the molecular formula C12H8Al2 and a molecular weight of 206.16 g/mol.
| Compound Name | CID 23585944 |
|---|---|
| PubChem CID | 23585944 |
| Molecular Formula | C12H8Al2 |
| Molecular Weight | 206.16 g/mol |
| Exact Mass | 206.03 |
| IUPAC Name | — |
| SMILES | [Al]c1ccc(-c2ccc([Al])cc2)cc1 |
| InChI | InChI=1S/C12H8.2Al/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;;/h3-10H;; |
| InChIKey | HYCKFXJAYFAMMR-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.16 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |