C16H11Br — CID 58142225
1-(4-bromo-2,3,5,6-tetradeuteriophenyl)-2,3,4,5,6,7,8-heptadeuterionaphthalene (PubChem CID 58142225) has the molecular formula C16H11Br and a molecular weight of 294.24 g/mol. Its IUPAC name is 1-(4-bromo-2,3,5,6-tetradeuteriophenyl)-2,3,4,5,6,7,8-heptadeuterionaphthalene.
| Compound Name | 1-(4-bromo-2,3,5,6-tetradeuteriophenyl)-2,3,4,5,6,7,8-heptadeuterionaphthalene |
|---|---|
| PubChem CID | 58142225 |
| Molecular Formula | C16H11Br |
| Molecular Weight | 294.24 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | 1-(4-bromo-2,3,5,6-tetradeuteriophenyl)-2,3,4,5,6,7,8-heptadeuterionaphthalene |
| SMILES | [2H]c1c([2H])c(-c2c([2H])c([2H])c([2H])c3c([2H])c([2H])c([2H])c([2H])c23)c([2H])c([2H])c1Br |
| InChI | InChI=1S/C16H11Br/c17-14-10-8-13(9-11-14)16-7-3-5-12-4-1-2-6-15(12)16/h1-11H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D,11D |
| InChIKey | YRPIGRRBBMFFBE-LFFOKYCESA-N |
| XLogP | 5.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.24 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |