C20H13Cl — CID 177076803
1-(6-chloro-1,3,4,5,7,8-hexadeuterionaphthalen-2-yl)-2,3,4,5,6,7,8-heptadeuterionaphthalene (PubChem CID 177076803) has the molecular formula C20H13Cl and a molecular weight of 301.86 g/mol. Its IUPAC name is 1-(6-chloro-1,3,4,5,7,8-hexadeuterionaphthalen-2-yl)-2,3,4,5,6,7,8-heptadeuterionaphthalene.
| Compound Name | 1-(6-chloro-1,3,4,5,7,8-hexadeuterionaphthalen-2-yl)-2,3,4,5,6,7,8-heptadeuterionaphthalene |
|---|---|
| PubChem CID | 177076803 |
| Molecular Formula | C20H13Cl |
| Molecular Weight | 301.86 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 1-(6-chloro-1,3,4,5,7,8-hexadeuterionaphthalen-2-yl)-2,3,4,5,6,7,8-heptadeuterionaphthalene |
| SMILES | [2H]c1c(-c2c([2H])c([2H])c([2H])c3c([2H])c([2H])c([2H])c([2H])c23)c([2H])c2c([2H])c([2H])c(Cl)c([2H])c2c1[2H] |
| InChI | InChI=1S/C20H13Cl/c21-18-11-10-15-12-17(9-8-16(15)13-18)20-7-3-5-14-4-1-2-6-19(14)20/h1-13H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D,11D,12D,13D |
| InChIKey | AJHGIIIKNVVHJV-WOBVQUITSA-N |
| XLogP | 6.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.86 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |