C12H8BrCl — CID 175970687
1-bromo-3-(3-chloro-2,4,5,6-tetradeuteriophenyl)-2,4,5,6-tetradeuteriobenzene (PubChem CID 175970687) has the molecular formula C12H8BrCl and a molecular weight of 275.60 g/mol. Its IUPAC name is 1-bromo-3-(3-chloro-2,4,5,6-tetradeuteriophenyl)-2,4,5,6-tetradeuteriobenzene.
| Compound Name | 1-bromo-3-(3-chloro-2,4,5,6-tetradeuteriophenyl)-2,4,5,6-tetradeuteriobenzene |
|---|---|
| PubChem CID | 175970687 |
| Molecular Formula | C12H8BrCl |
| Molecular Weight | 275.60 g/mol |
| Exact Mass | 274.00 |
| IUPAC Name | 1-bromo-3-(3-chloro-2,4,5,6-tetradeuteriophenyl)-2,4,5,6-tetradeuteriobenzene |
| SMILES | [2H]c1c([2H])c(Cl)c([2H])c(-c2c([2H])c([2H])c([2H])c(Br)c2[2H])c1[2H] |
| InChI | InChI=1S/C12H8BrCl/c13-11-5-1-3-9(7-11)10-4-2-6-12(14)8-10/h1-8H/i1D,2D,3D,4D,5D,6D,7D,8D |
| InChIKey | XDPLWYUXKVCBFV-PGRXLJNUSA-N |
| XLogP | 4.77 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.60 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |