C6H4Br2 — CID 177285460
1,5-dibromo-2,3,4-trideuteriobenzene (PubChem CID 177285460) has the molecular formula C6H4Br2 and a molecular weight of 238.92 g/mol. Its IUPAC name is 1,5-dibromo-2,3,4-trideuteriobenzene.
| Compound Name | 1,5-dibromo-2,3,4-trideuteriobenzene |
|---|---|
| PubChem CID | 177285460 |
| Molecular Formula | C6H4Br2 |
| Molecular Weight | 238.92 g/mol |
| Exact Mass | 236.89 |
| IUPAC Name | 1,5-dibromo-2,3,4-trideuteriobenzene |
| SMILES | [2H]c1c(Br)cc(Br)c([2H])c1[2H] |
| InChI | InChI=1S/C6H4Br2/c7-5-2-1-3-6(8)4-5/h1-4H/i1D,2D,3D |
| InChIKey | JSRLURSZEMLAFO-CBYSEHNBSA-N |
| XLogP | 3.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.92 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |