C13H13Br2I — CID 160545295
1-bromo-2,3,4,5,6-pentadeuteriobenzene;1-bromo-2,3,5,6-tetradeuterio-4-iodobenzene;methane (PubChem CID 160545295) has the molecular formula C13H13Br2I and a molecular weight of 465.01 g/mol. Its IUPAC name is 1-bromo-2,3,4,5,6-pentadeuteriobenzene;1-bromo-2,3,5,6-tetradeuterio-4-iodobenzene;methane.
| Compound Name | 1-bromo-2,3,4,5,6-pentadeuteriobenzene;1-bromo-2,3,5,6-tetradeuterio-4-iodobenzene;methane |
|---|---|
| PubChem CID | 160545295 |
| Molecular Formula | C13H13Br2I |
| Molecular Weight | 465.01 g/mol |
| Exact Mass | 462.90 |
| IUPAC Name | 1-bromo-2,3,4,5,6-pentadeuteriobenzene;1-bromo-2,3,5,6-tetradeuterio-4-iodobenzene;methane |
| SMILES | C.[2H]c1c([2H])c(I)c([2H])c([2H])c1Br.[2H]c1c([2H])c([2H])c(Br)c([2H])c1[2H] |
| InChI | InChI=1S/C6H4BrI.C6H5Br.CH4/c7-5-1-3-6(8)4-2-5;7-6-4-2-1-3-5-6;/h1-4H;1-5H;1H4/i1D,2D,3D,4D;1D,2D,3D,4D,5D; |
| InChIKey | QXIPQIAVVJWRBA-GDMXBRTASA-N |
| XLogP | 6.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.01 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|