C6H6 — CID 101103333
1,2,3,4,5,6-hexadeuterio(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene (PubChem CID 101103333) has the molecular formula C6H6 and a molecular weight of 90.10 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexadeuterio(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene.
| Compound Name | 1,2,3,4,5,6-hexadeuterio(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene |
|---|---|
| PubChem CID | 101103333 |
| Molecular Formula | C6H6 |
| Molecular Weight | 90.10 g/mol |
| Exact Mass | 90.10 |
| IUPAC Name | 1,2,3,4,5,6-hexadeuterio(1,2,3,4,5,6-13C6)cyclohexa-1,3,5-triene |
| SMILES | [2H][13c]1[13c]([2H])[13c]([2H])[13c]([2H])[13c]([2H])[13c]1[2H] |
| InChI | InChI=1S/C6H6/c1-2-4-6-5-3-1/h1-6H/i1+1D,2+1D,3+1D,4+1D,5+1D,6+1D |
| InChIKey | UHOVQNZJYSORNB-PCEJJIFQSA-N |
| XLogP | 1.69 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 90.10 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |