C10H10Fe — CID 102602328
Iron;1,2,3,4,5-pentadeuteriocyclopentane (PubChem CID 102602328) has the molecular formula C10H10Fe and a molecular weight of 196.10 g/mol.
| Compound Name | Iron;1,2,3,4,5-pentadeuteriocyclopentane |
|---|---|
| PubChem CID | 102602328 |
| Molecular Formula | C10H10Fe |
| Molecular Weight | 196.10 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | — |
| SMILES | [2H][C]1[C]([2H])[C]([2H])[C]([2H])[C]1[2H].[2H][C]1[C]([2H])[C]([2H])[C]([2H])[C]1[2H].[Fe] |
| InChI | InChI=1S/2C5H5.Fe/c2*1-2-4-5-3-1;/h2*1-5H;/i2*1D,2D,3D,4D,5D; |
| InChIKey | DFRHTHSZMBROSH-DQPUZLHUSA-N |
| XLogP | 2.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.10 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|