C15H11N3 — CID 87305393
2,4-bis(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazine (PubChem CID 87305393) has the molecular formula C15H11N3 and a molecular weight of 243.34 g/mol. Its IUPAC name is 2,4-bis(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazine.
| Compound Name | 2,4-bis(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazine |
|---|---|
| PubChem CID | 87305393 |
| Molecular Formula | C15H11N3 |
| Molecular Weight | 243.34 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 2,4-bis(2,3,4,5,6-pentadeuteriophenyl)-1,3,5-triazine |
| SMILES | [2H]c1c([2H])c([2H])c(-c2ncnc(-c3c([2H])c([2H])c([2H])c([2H])c3[2H])n2)c([2H])c1[2H] |
| InChI | InChI=1S/C15H11N3/c1-3-7-12(8-4-1)14-16-11-17-15(18-14)13-9-5-2-6-10-13/h1-11H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D |
| InChIKey | OTJZMNIBLUCUJZ-LHNTUAQVSA-N |
| XLogP | 3.21 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.34 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |