C10H7Br — CID 89310078
2-bromo-1,3,4,5,6,7,8-heptadeuterionaphthalene (PubChem CID 89310078) has the molecular formula C10H7Br and a molecular weight of 214.11 g/mol. Its IUPAC name is 2-bromo-1,3,4,5,6,7,8-heptadeuterionaphthalene.
| Compound Name | 2-bromo-1,3,4,5,6,7,8-heptadeuterionaphthalene |
|---|---|
| PubChem CID | 89310078 |
| Molecular Formula | C10H7Br |
| Molecular Weight | 214.11 g/mol |
| Exact Mass | 213.02 |
| IUPAC Name | 2-bromo-1,3,4,5,6,7,8-heptadeuterionaphthalene |
| SMILES | [2H]c1c([2H])c([2H])c2c([2H])c(Br)c([2H])c([2H])c2c1[2H] |
| InChI | InChI=1S/C10H7Br/c11-10-6-5-8-3-1-2-4-9(8)7-10/h1-7H/i1D,2D,3D,4D,5D,6D,7D |
| InChIKey | APSMUYYLXZULMS-GSNKEKJESA-N |
| XLogP | 3.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.11 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |