C16H10BrCl — CID 171731254
2-bromo-6-(3-chloro-2,4,5,6-tetradeuteriophenyl)naphthalene (PubChem CID 171731254) has the molecular formula C16H10BrCl and a molecular weight of 321.64 g/mol. Its IUPAC name is 2-bromo-6-(3-chloro-2,4,5,6-tetradeuteriophenyl)naphthalene.
| Compound Name | 2-bromo-6-(3-chloro-2,4,5,6-tetradeuteriophenyl)naphthalene |
|---|---|
| PubChem CID | 171731254 |
| Molecular Formula | C16H10BrCl |
| Molecular Weight | 321.64 g/mol |
| Exact Mass | 319.99 |
| IUPAC Name | 2-bromo-6-(3-chloro-2,4,5,6-tetradeuteriophenyl)naphthalene |
| SMILES | [2H]c1c([2H])c(Cl)c([2H])c(-c2ccc3cc(Br)ccc3c2)c1[2H] |
| InChI | InChI=1S/C16H10BrCl/c17-15-7-6-13-8-12(4-5-14(13)9-15)11-2-1-3-16(18)10-11/h1-10H/i1D,2D,3D,10D |
| InChIKey | XNMBOKPGUFCYDP-ATCXJBGESA-N |
| XLogP | 5.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.64 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |