C29H18ClN3 — CID 171469862
2-(3-chloro-2,4,6-trideuteriophenyl)-4,6-dinaphthalen-2-yl-1,3,5-triazine (PubChem CID 171469862) has the molecular formula C29H18ClN3 and a molecular weight of 446.96 g/mol. Its IUPAC name is 2-(3-chloro-2,4,6-trideuteriophenyl)-4,6-dinaphthalen-2-yl-1,3,5-triazine.
| Compound Name | 2-(3-chloro-2,4,6-trideuteriophenyl)-4,6-dinaphthalen-2-yl-1,3,5-triazine |
|---|---|
| PubChem CID | 171469862 |
| Molecular Formula | C29H18ClN3 |
| Molecular Weight | 446.96 g/mol |
| Exact Mass | 446.14 |
| IUPAC Name | 2-(3-chloro-2,4,6-trideuteriophenyl)-4,6-dinaphthalen-2-yl-1,3,5-triazine |
| SMILES | [2H]c1cc([2H])c(-c2nc(-c3ccc4ccccc4c3)nc(-c3ccc4ccccc4c3)n2)c([2H])c1Cl |
| InChI | InChI=1S/C29H18ClN3/c30-26-11-5-10-23(18-26)27-31-28(24-14-12-19-6-1-3-8-21(19)16-24)33-29(32-27)25-15-13-20-7-2-4-9-22(20)17-25/h1-18H/i10D,11D,18D |
| InChIKey | IRJUEQRHOUVOLW-CHYKZQLPSA-N |
| XLogP | 7.83 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.96 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |