C33H24N3Sb — CID 164717588
tris[2,3,4,5-tetradeuterio-6-(3,4,5,6-tetradeuterio-2-pyridinyl)phenyl]stibane (PubChem CID 164717588) has the molecular formula C33H24N3Sb and a molecular weight of 608.48 g/mol. Its IUPAC name is tris[2,3,4,5-tetradeuterio-6-(3,4,5,6-tetradeuterio-2-pyridinyl)phenyl]stibane.
| Compound Name | tris[2,3,4,5-tetradeuterio-6-(3,4,5,6-tetradeuterio-2-pyridinyl)phenyl]stibane |
|---|---|
| PubChem CID | 164717588 |
| Molecular Formula | C33H24N3Sb |
| Molecular Weight | 608.48 g/mol |
| Exact Mass | 607.25 |
| IUPAC Name | tris[2,3,4,5-tetradeuterio-6-(3,4,5,6-tetradeuterio-2-pyridinyl)phenyl]stibane |
| SMILES | [2H]c1nc(-c2c([2H])c([2H])c([2H])c([2H])c2[Sb](c2c([2H])c([2H])c([2H])c([2H])c2-c2nc([2H])c([2H])c([2H])c2[2H])c2c([2H])c([2H])c([2H])c([2H])c2-c2nc([2H])c([2H])c([2H])c2[2H])c([2H])c([2H])c1[2H] |
| InChI | InChI=1S/3C11H8N.Sb/c3*1-2-6-10(7-3-1)11-8-4-5-9-12-11;/h3*1-6,8-9H;/i3*1D,2D,3D,4D,5D,6D,8D,9D; |
| InChIKey | VBUZAEHBMJVAKH-AZBGJXTFSA-N |
| XLogP | 5.39 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.48 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|