C19H12O3S — CID 155529320
1,1-dioxo-2-phenylbenzo[h]thiochromen-4-one (PubChem CID 155529320) has the molecular formula C19H12O3S and a molecular weight of 320.37 g/mol. Its IUPAC name is 1,1-dioxo-2-phenylbenzo[h]thiochromen-4-one.
| Compound Name | 1,1-dioxo-2-phenylbenzo[h]thiochromen-4-one |
|---|---|
| PubChem CID | 155529320 |
| Molecular Formula | C19H12O3S |
| Molecular Weight | 320.37 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | 1,1-dioxo-2-phenylbenzo[h]thiochromen-4-one |
| SMILES | O=C1C=C(c2ccccc2)S(=O)(=O)c2c1ccc1ccccc21 |
| InChI | InChI=1S/C19H12O3S/c20-17-12-18(14-7-2-1-3-8-14)23(21,22)19-15-9-5-4-6-13(15)10-11-16(17)19/h1-12H |
| InChIKey | ZQDVSNDMKQZBKC-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |