C13H8O4S — CID 117061012
(2E)-2-(furan-2-ylmethylidene)-1,1-dioxo-1-benzothiophen-3-one (PubChem CID 117061012) has the molecular formula C13H8O4S and a molecular weight of 260.27 g/mol. Its IUPAC name is (2E)-2-(furan-2-ylmethylidene)-1,1-dioxo-1-benzothiophen-3-one.
| Compound Name | (2E)-2-(furan-2-ylmethylidene)-1,1-dioxo-1-benzothiophen-3-one |
|---|---|
| PubChem CID | 117061012 |
| Molecular Formula | C13H8O4S |
| Molecular Weight | 260.27 g/mol |
| Exact Mass | 260.01 |
| IUPAC Name | (2E)-2-(furan-2-ylmethylidene)-1,1-dioxo-1-benzothiophen-3-one |
| SMILES | O=C1/C(=C\c2ccco2)S(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C13H8O4S/c14-13-10-5-1-2-6-11(10)18(15,16)12(13)8-9-4-3-7-17-9/h1-8H/b12-8+ |
| InChIKey | BZECDRLNFVCTAJ-XYOKQWHBSA-N |
| XLogP | 2.29 |
| TPSA | 64.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.27 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_five_het_I(6)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|