C20H14O3 — CID 838807
(2S,3Z)-3-(furan-2-ylmethylidene)-2-phenylchromen-4-one (PubChem CID 838807) has the molecular formula C20H14O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is (2S,3Z)-3-(furan-2-ylmethylidene)-2-phenylchromen-4-one.
| Compound Name | (2S,3Z)-3-(furan-2-ylmethylidene)-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 838807 |
| Molecular Formula | C20H14O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | (2S,3Z)-3-(furan-2-ylmethylidene)-2-phenylchromen-4-one |
| SMILES | O=C1/C(=C\c2ccco2)[C@H](c2ccccc2)Oc2ccccc21 |
| InChI | InChI=1S/C20H14O3/c21-19-16-10-4-5-11-18(16)23-20(14-7-2-1-3-8-14)17(19)13-15-9-6-12-22-15/h1-13,20H/b17-13+/t20-/m0/s1 |
| InChIKey | XTMGRNIXXUJHEV-NXNYUAIASA-N |
| XLogP | 4.68 |
| TPSA | 39.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|