C23H16O4 — CID 6977118
(2S,3Z)-3-(1,3-benzodioxol-5-ylmethylidene)-2-phenylchromen-4-one (PubChem CID 6977118) has the molecular formula C23H16O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is (2S,3Z)-3-(1,3-benzodioxol-5-ylmethylidene)-2-phenylchromen-4-one.
| Compound Name | (2S,3Z)-3-(1,3-benzodioxol-5-ylmethylidene)-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 6977118 |
| Molecular Formula | C23H16O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | (2S,3Z)-3-(1,3-benzodioxol-5-ylmethylidene)-2-phenylchromen-4-one |
| SMILES | O=C1/C(=C\c2ccc3c(c2)OCO3)[C@H](c2ccccc2)Oc2ccccc21 |
| InChI | InChI=1S/C23H16O4/c24-22-17-8-4-5-9-19(17)27-23(16-6-2-1-3-7-16)18(22)12-15-10-11-20-21(13-15)26-14-25-20/h1-13,23H,14H2/b18-12+/t23-/m0/s1 |
| InChIKey | WYGWELPFUYJZON-SJQUQUAPSA-N |
| XLogP | 4.82 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|