About (2R,3Z)-3-(1,3-benzodioxol-5-ylmethylidene)-2-phenylchromen-4-one
(2R,3Z)-3-(1,3-benzodioxol-5-ylmethylidene)-2-phenylchromen-4-one (PubChem CID 6977119) has the molecular formula C23H16O4
and a molecular weight of 356.38 g/mol. Its IUPAC name is (2R,3Z)-3-(1,3-benzodioxol-5-ylmethylidene)-2-phenylchromen-4-one.
Molecular Properties
| Compound Name | (2R,3Z)-3-(1,3-benzodioxol-5-ylmethylidene)-2-phenylchromen-4-one |
| PubChem CID | 6977119 |
| Molecular Formula | C23H16O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | (2R,3Z)-3-(1,3-benzodioxol-5-ylmethylidene)-2-phenylchromen-4-one |
| SMILES | O=C1/C(=C\c2ccc3c(c2)OCO3)[C@@H](c2ccccc2)Oc2ccccc21 |
| InChI | InChI=1S/C23H16O4/c24-22-17-8-4-5-9-19(17)27-23(16-6-2-1-3-7-16)18(22)12-15-10-11-20-21(13-15)26-14-25-20/h1-13,23H,14H2/b18-12+/t23-/m1/s1 |
| InChIKey | WYGWELPFUYJZON-FUAYJARZSA-N |
| XLogP | 4.82 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2R,3Z)-3-(1,3-benzodioxol-5-ylmethylidene)-2-phenylchromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3Z)-3-(1,3-benzodioxol-5-ylmethylidene)-2-phenylchromen-4-one?
The IUPAC name of (2R,3Z)-3-(1,3-benzodioxol-5-ylmethylidene)-2-phenylchromen-4-one (CID 6977119) is (2R,3Z)-3-(1,3-benzodioxol-5-ylmethylidene)-2-phenylchromen-4-one.
What is the SMILES notation for (2R,3Z)-3-(1,3-benzodioxol-5-ylmethylidene)-2-phenylchromen-4-one?
The canonical SMILES for (2R,3Z)-3-(1,3-benzodioxol-5-ylmethylidene)-2-phenylchromen-4-one is O=C1/C(=C\c2ccc3c(c2)OCO3)[C@@H](c2ccccc2)Oc2ccccc21.
What is the InChIKey of (2R,3Z)-3-(1,3-benzodioxol-5-ylmethylidene)-2-phenylchromen-4-one?
The InChIKey is WYGWELPFUYJZON-FUAYJARZSA-N. The full InChI is InChI=1S/C23H16O4/c24-22-17-8-4-5-9-19(17)27-23(16-6-2-1-3-7-16)18(22)12-15-10-11-20-21(13-15)26-14-25-20/h1-13,23H,14H2/b18-12+/t23-/m1/s1.
What are the key properties of (2R,3Z)-3-(1,3-benzodioxol-5-ylmethylidene)-2-phenylchromen-4-one?
(2R,3Z)-3-(1,3-benzodioxol-5-ylmethylidene)-2-phenylchromen-4-one has a molecular weight of 356.38 g/mol, XLogP of 4.82, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3Z)-3-(1,3-benzodioxol-5-ylmethylidene)-2-phenylchromen-4-one is sourced from PubChem (CID 6977119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).