C24H18O4 — CID 7998178
(2S,3E)-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-2-phenylchromen-4-one (PubChem CID 7998178) has the molecular formula C24H18O4 and a molecular weight of 370.40 g/mol. Its IUPAC name is (2S,3E)-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-2-phenylchromen-4-one.
| Compound Name | (2S,3E)-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-2-phenylchromen-4-one |
|---|---|
| PubChem CID | 7998178 |
| Molecular Formula | C24H18O4 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | (2S,3E)-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethylidene)-2-phenylchromen-4-one |
| SMILES | O=C1/C(=C/c2ccc3c(c2)OCCO3)[C@H](c2ccccc2)Oc2ccccc21 |
| InChI | InChI=1S/C24H18O4/c25-23-18-8-4-5-9-20(18)28-24(17-6-2-1-3-7-17)19(23)14-16-10-11-21-22(15-16)27-13-12-26-21/h1-11,14-15,24H,12-13H2/b19-14-/t24-/m0/s1 |
| InChIKey | FJAZYDKJXAFRRS-CSDGDXGTSA-N |
| XLogP | 4.86 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|