C23H16N4O2 — CID 7036488
(2R)-2-phenyl-3-[[4-(2H-tetrazol-5-yl)phenyl]methylidene]chromen-4-one (PubChem CID 7036488) has the molecular formula C23H16N4O2 and a molecular weight of 380.41 g/mol. Its IUPAC name is (2R)-2-phenyl-3-[[4-(2H-tetrazol-5-yl)phenyl]methylidene]chromen-4-one.
| Compound Name | (2R)-2-phenyl-3-[[4-(2H-tetrazol-5-yl)phenyl]methylidene]chromen-4-one |
|---|---|
| PubChem CID | 7036488 |
| Molecular Formula | C23H16N4O2 |
| Molecular Weight | 380.41 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | (2R)-2-phenyl-3-[[4-(2H-tetrazol-5-yl)phenyl]methylidene]chromen-4-one |
| SMILES | O=C1C(=Cc2ccc(-c3nn[nH]n3)cc2)[C@@H](c2ccccc2)Oc2ccccc21 |
| InChI | InChI=1S/C23H16N4O2/c28-21-18-8-4-5-9-20(18)29-22(16-6-2-1-3-7-16)19(21)14-15-10-12-17(13-11-15)23-24-26-27-25-23/h1-14,22H,(H,24,25,26,27)/t22-/m1/s1 |
| InChIKey | QAVWDMZNEFIQHK-JOCHJYFZSA-N |
| XLogP | 4.27 |
| TPSA | 80.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.41 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|