C25H16O6S2 — CID 91406597
1,1-dioxo-2-[2-phenyl-3-(1,1,3-trioxo-1-benzothiophen-2-ylidene)propylidene]-1-benzothiophen-3-one (PubChem CID 91406597) has the molecular formula C25H16O6S2 and a molecular weight of 476.53 g/mol. Its IUPAC name is 1,1-dioxo-2-[2-phenyl-3-(1,1,3-trioxo-1-benzothiophen-2-ylidene)propylidene]-1-benzothiophen-3-one.
| Compound Name | 1,1-dioxo-2-[2-phenyl-3-(1,1,3-trioxo-1-benzothiophen-2-ylidene)propylidene]-1-benzothiophen-3-one |
|---|---|
| PubChem CID | 91406597 |
| Molecular Formula | C25H16O6S2 |
| Molecular Weight | 476.53 g/mol |
| Exact Mass | 476.04 |
| IUPAC Name | 1,1-dioxo-2-[2-phenyl-3-(1,1,3-trioxo-1-benzothiophen-2-ylidene)propylidene]-1-benzothiophen-3-one |
| SMILES | O=C1C(=CC(C=C2C(=O)c3ccccc3S2(=O)=O)c2ccccc2)S(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C25H16O6S2/c26-24-18-10-4-6-12-20(18)32(28,29)22(24)14-17(16-8-2-1-3-9-16)15-23-25(27)19-11-5-7-13-21(19)33(23,30)31/h1-15,17H |
| InChIKey | WKACYUKFBYBZCK-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.53 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|