C46H28N6OS — CID 140731455
10-[4-[4-(4-isocyanophenyl)-6-(4-phenothiazin-10-ylphenyl)-1,3,5-triazin-2-yl]phenyl]phenoxazine (PubChem CID 140731455) has the molecular formula C46H28N6OS and a molecular weight of 712.84 g/mol. Its IUPAC name is 10-[4-[4-(4-isocyanophenyl)-6-(4-phenothiazin-10-ylphenyl)-1,3,5-triazin-2-yl]phenyl]phenoxazine.
| Compound Name | 10-[4-[4-(4-isocyanophenyl)-6-(4-phenothiazin-10-ylphenyl)-1,3,5-triazin-2-yl]phenyl]phenoxazine |
|---|---|
| PubChem CID | 140731455 |
| Molecular Formula | C46H28N6OS |
| Molecular Weight | 712.84 g/mol |
| Exact Mass | 712.20 |
| IUPAC Name | 10-[4-[4-(4-isocyanophenyl)-6-(4-phenothiazin-10-ylphenyl)-1,3,5-triazin-2-yl]phenyl]phenoxazine |
| SMILES | [C-]#[N+]c1ccc(-c2nc(-c3ccc(N4c5ccccc5Oc5ccccc54)cc3)nc(-c3ccc(N4c5ccccc5Sc5ccccc54)cc3)n2)cc1 |
| InChI | InChI=1S/C46H28N6OS/c1-47-33-24-18-30(19-25-33)44-48-45(31-20-26-34(27-21-31)51-36-10-2-6-14-40(36)53-41-15-7-3-11-37(41)51)50-46(49-44)32-22-28-35(29-23-32)52-38-12-4-8-16-42(38)54-43-17-9-5-13-39(43)52/h2-29H |
| InChIKey | APHCTUCLADNUOS-UHFFFAOYSA-N |
| XLogP | 12.93 |
| TPSA | 58.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.84 |
| LogP ≤ 5 | 12.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|