C26H17N5O — CID 58251220
10-[3,5-di(pyrimidin-5-yl)phenyl]phenoxazine (PubChem CID 58251220) has the molecular formula C26H17N5O and a molecular weight of 415.46 g/mol. Its IUPAC name is 10-[3,5-di(pyrimidin-5-yl)phenyl]phenoxazine.
| Compound Name | 10-[3,5-di(pyrimidin-5-yl)phenyl]phenoxazine |
|---|---|
| PubChem CID | 58251220 |
| Molecular Formula | C26H17N5O |
| Molecular Weight | 415.46 g/mol |
| Exact Mass | 415.14 |
| IUPAC Name | 10-[3,5-di(pyrimidin-5-yl)phenyl]phenoxazine |
| SMILES | c1ccc2c(c1)Oc1ccccc1N2c1cc(-c2cncnc2)cc(-c2cncnc2)c1 |
| InChI | InChI=1S/C26H17N5O/c1-3-7-25-23(5-1)31(24-6-2-4-8-26(24)32-25)22-10-18(20-12-27-16-28-13-20)9-19(11-22)21-14-29-17-30-15-21/h1-17H |
| InChIKey | RARUOKZZILQXIE-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 64.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.46 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |