C62H53NO — CID 58251251
10-[3,5-bis[3,5-bis(4-ethylphenyl)phenyl]phenyl]phenoxazine (PubChem CID 58251251) has the molecular formula C62H53NO and a molecular weight of 828.11 g/mol. Its IUPAC name is 10-[3,5-bis[3,5-bis(4-ethylphenyl)phenyl]phenyl]phenoxazine.
| Compound Name | 10-[3,5-bis[3,5-bis(4-ethylphenyl)phenyl]phenyl]phenoxazine |
|---|---|
| PubChem CID | 58251251 |
| Molecular Formula | C62H53NO |
| Molecular Weight | 828.11 g/mol |
| Exact Mass | 827.41 |
| IUPAC Name | 10-[3,5-bis[3,5-bis(4-ethylphenyl)phenyl]phenyl]phenoxazine |
| SMILES | CCc1ccc(-c2cc(-c3ccc(CC)cc3)cc(-c3cc(-c4cc(-c5ccc(CC)cc5)cc(-c5ccc(CC)cc5)c4)cc(N4c5ccccc5Oc5ccccc54)c3)c2)cc1 |
| InChI | InChI=1S/C62H53NO/c1-5-42-17-25-46(26-18-42)50-33-51(47-27-19-43(6-2)20-28-47)36-54(35-50)56-39-57(41-58(40-56)63-59-13-9-11-15-61(59)64-62-16-12-10-14-60(62)63)55-37-52(48-29-21-44(7-3)22-30-48)34-53(38-55)49-31-23-45(8-4)24-32-49/h9-41H,5-8H2,1-4H3 |
| InChIKey | YASYOVKFKJCPHD-UHFFFAOYSA-N |
| XLogP | 17.51 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.11 |
| LogP ≤ 5 | 17.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |