C37H30N4O — CID 118528361
10-[4-[4,6-bis(4-ethylphenyl)-1,3,5-triazin-2-yl]phenyl]phenoxazine (PubChem CID 118528361) has the molecular formula C37H30N4O and a molecular weight of 546.67 g/mol. Its IUPAC name is 10-[4-[4,6-bis(4-ethylphenyl)-1,3,5-triazin-2-yl]phenyl]phenoxazine.
| Compound Name | 10-[4-[4,6-bis(4-ethylphenyl)-1,3,5-triazin-2-yl]phenyl]phenoxazine |
|---|---|
| PubChem CID | 118528361 |
| Molecular Formula | C37H30N4O |
| Molecular Weight | 546.67 g/mol |
| Exact Mass | 546.24 |
| IUPAC Name | 10-[4-[4,6-bis(4-ethylphenyl)-1,3,5-triazin-2-yl]phenyl]phenoxazine |
| SMILES | CCc1ccc(-c2nc(-c3ccc(CC)cc3)nc(-c3ccc(N4c5ccccc5Oc5ccccc54)cc3)n2)cc1 |
| InChI | InChI=1S/C37H30N4O/c1-3-25-13-17-27(18-14-25)35-38-36(28-19-15-26(4-2)16-20-28)40-37(39-35)29-21-23-30(24-22-29)41-31-9-5-7-11-33(31)42-34-12-8-6-10-32(34)41/h5-24H,3-4H2,1-2H3 |
| InChIKey | WPDPEWHVRSILQQ-UHFFFAOYSA-N |
| XLogP | 9.57 |
| TPSA | 51.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.67 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |