C100H64N10 — CID 122606818
3,5-bis[3,6-bis(N-phenylanilino)carbazol-9-yl]-2,4-bis(4-cyanophenyl)-6-(4-isocyanophenyl)benzonitrile (PubChem CID 122606818) has the molecular formula C100H64N10 and a molecular weight of 1405.68 g/mol. Its IUPAC name is 3,5-bis[3,6-bis(N-phenylanilino)carbazol-9-yl]-2,4-bis(4-cyanophenyl)-6-(4-isocyanophenyl)benzonitrile.
| Compound Name | 3,5-bis[3,6-bis(N-phenylanilino)carbazol-9-yl]-2,4-bis(4-cyanophenyl)-6-(4-isocyanophenyl)benzonitrile |
|---|---|
| PubChem CID | 122606818 |
| Molecular Formula | C100H64N10 |
| Molecular Weight | 1405.68 g/mol |
| Exact Mass | 1404.53 |
| IUPAC Name | 3,5-bis[3,6-bis(N-phenylanilino)carbazol-9-yl]-2,4-bis(4-cyanophenyl)-6-(4-isocyanophenyl)benzonitrile |
| SMILES | [C-]#[N+]c1ccc(-c2c(C#N)c(-c3ccc(C#N)cc3)c(-n3c4ccc(N(c5ccccc5)c5ccccc5)cc4c4cc(N(c5ccccc5)c5ccccc5)ccc43)c(-c3ccc(C#N)cc3)c2-n2c3ccc(N(c4ccccc4)c4ccccc4)cc3c3cc(N(c4ccccc4)c4ccccc4)ccc32)cc1 |
| InChI | InChI=1S/C100H64N10/c1-104-74-52-50-72(51-53-74)97-91(68-103)96(71-46-42-69(66-101)43-47-71)99(109-92-58-54-83(105(75-26-10-2-11-27-75)76-28-12-3-13-29-76)62-87(92)88-63-84(55-59-93(88)109)106(77-30-14-4-15-31-77)78-32-16-5-17-33-78)98(73-48-44-70(67-102)45-49-73)100(97)110-94-60-56-85(107(79-34-18-6-19-35-79)80-36-20-7-21-37-80)64-89(94)90-65-86(57-61-95(90)110)108(81-38-22-8-23-39-81)82-40-24-9-25-41-82/h2-65H |
| InChIKey | ABRLWSGSQXKFJJ-UHFFFAOYSA-N |
| XLogP | 26.93 |
| TPSA | 98.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 110 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1405.68 |
| LogP ≤ 5 | 26.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|