C50H33FN4Si — CID 88953993
4-(N-[9-(4-fluorophenyl)-6-triphenylsilylcarbazol-3-yl]-4-isocyanoanilino)benzonitrile (PubChem CID 88953993) has the molecular formula C50H33FN4Si and a molecular weight of 736.93 g/mol. Its IUPAC name is 4-(N-[9-(4-fluorophenyl)-6-triphenylsilylcarbazol-3-yl]-4-isocyanoanilino)benzonitrile.
| Compound Name | 4-(N-[9-(4-fluorophenyl)-6-triphenylsilylcarbazol-3-yl]-4-isocyanoanilino)benzonitrile |
|---|---|
| PubChem CID | 88953993 |
| Molecular Formula | C50H33FN4Si |
| Molecular Weight | 736.93 g/mol |
| Exact Mass | 736.25 |
| IUPAC Name | 4-(N-[9-(4-fluorophenyl)-6-triphenylsilylcarbazol-3-yl]-4-isocyanoanilino)benzonitrile |
| SMILES | [C-]#[N+]c1ccc(N(c2ccc(C#N)cc2)c2ccc3c(c2)c2cc([Si](c4ccccc4)(c4ccccc4)c4ccccc4)ccc2n3-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C50H33FN4Si/c1-53-38-21-27-40(28-22-38)54(39-23-17-36(35-52)18-24-39)42-29-31-49-47(33-42)48-34-46(30-32-50(48)55(49)41-25-19-37(51)20-26-41)56(43-11-5-2-6-12-43,44-13-7-3-8-14-44)45-15-9-4-10-16-45/h2-34H |
| InChIKey | DRQWROPKFQZZPU-UHFFFAOYSA-N |
| XLogP | 10.19 |
| TPSA | 36.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 736.93 |
| LogP ≤ 5 | 10.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|