C57H41N3OSi2 — CID 59469965
4-[[6-[(4-isocyanophenyl)-diphenylsilyl]-9-(4-methoxyphenyl)carbazol-3-yl]-diphenylsilyl]benzonitrile (PubChem CID 59469965) has the molecular formula C57H41N3OSi2 and a molecular weight of 840.15 g/mol. Its IUPAC name is 4-[[6-[(4-isocyanophenyl)-diphenylsilyl]-9-(4-methoxyphenyl)carbazol-3-yl]-diphenylsilyl]benzonitrile.
| Compound Name | 4-[[6-[(4-isocyanophenyl)-diphenylsilyl]-9-(4-methoxyphenyl)carbazol-3-yl]-diphenylsilyl]benzonitrile |
|---|---|
| PubChem CID | 59469965 |
| Molecular Formula | C57H41N3OSi2 |
| Molecular Weight | 840.15 g/mol |
| Exact Mass | 839.28 |
| IUPAC Name | 4-[[6-[(4-isocyanophenyl)-diphenylsilyl]-9-(4-methoxyphenyl)carbazol-3-yl]-diphenylsilyl]benzonitrile |
| SMILES | [C-]#[N+]c1ccc([Si](c2ccccc2)(c2ccccc2)c2ccc3c(c2)c2cc([Si](c4ccccc4)(c4ccccc4)c4ccc(C#N)cc4)ccc2n3-c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C57H41N3OSi2/c1-59-43-25-33-51(34-26-43)63(48-19-11-5-12-20-48,49-21-13-6-14-22-49)53-36-38-57-55(40-53)54-39-52(35-37-56(54)60(57)44-27-29-45(61-2)30-28-44)62(46-15-7-3-8-16-46,47-17-9-4-10-18-47)50-31-23-42(41-58)24-32-50/h3-40H,2H3 |
| InChIKey | QGCLGCLHGRLOEC-UHFFFAOYSA-N |
| XLogP | 7.97 |
| TPSA | 42.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 840.15 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|