C56H45NOSi2 — CID 58131160
[9-(3-methoxy-5-methylphenyl)-6-triphenylsilylcarbazol-3-yl]-triphenylsilane (PubChem CID 58131160) has the molecular formula C56H45NOSi2 and a molecular weight of 804.15 g/mol. Its IUPAC name is [9-(3-methoxy-5-methylphenyl)-6-triphenylsilylcarbazol-3-yl]-triphenylsilane.
| Compound Name | [9-(3-methoxy-5-methylphenyl)-6-triphenylsilylcarbazol-3-yl]-triphenylsilane |
|---|---|
| PubChem CID | 58131160 |
| Molecular Formula | C56H45NOSi2 |
| Molecular Weight | 804.15 g/mol |
| Exact Mass | 803.30 |
| IUPAC Name | [9-(3-methoxy-5-methylphenyl)-6-triphenylsilylcarbazol-3-yl]-triphenylsilane |
| SMILES | COc1cc(C)cc(-n2c3ccc([Si](c4ccccc4)(c4ccccc4)c4ccccc4)cc3c3cc([Si](c4ccccc4)(c4ccccc4)c4ccccc4)ccc32)c1 |
| InChI | InChI=1S/C56H45NOSi2/c1-42-37-43(39-44(38-42)58-2)57-55-35-33-51(59(45-21-9-3-10-22-45,46-23-11-4-12-24-46)47-25-13-5-14-26-47)40-53(55)54-41-52(34-36-56(54)57)60(48-27-15-6-16-28-48,49-29-17-7-18-30-49)50-31-19-8-20-32-50/h3-41H,1-2H3 |
| InChIKey | ORZJZFMISNKSJB-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 804.15 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|