C60H45NO2P2Si — CID 87159557
[6-diphenylphosphoryl-9-(4-diphenylphosphorylphenyl)carbazol-3-yl]-triphenylsilane (PubChem CID 87159557) has the molecular formula C60H45NO2P2Si and a molecular weight of 902.06 g/mol. Its IUPAC name is [6-diphenylphosphoryl-9-(4-diphenylphosphorylphenyl)carbazol-3-yl]-triphenylsilane.
| Compound Name | [6-diphenylphosphoryl-9-(4-diphenylphosphorylphenyl)carbazol-3-yl]-triphenylsilane |
|---|---|
| PubChem CID | 87159557 |
| Molecular Formula | C60H45NO2P2Si |
| Molecular Weight | 902.06 g/mol |
| Exact Mass | 901.27 |
| IUPAC Name | [6-diphenylphosphoryl-9-(4-diphenylphosphorylphenyl)carbazol-3-yl]-triphenylsilane |
| SMILES | O=P(c1ccccc1)(c1ccccc1)c1ccc(-n2c3ccc([Si](c4ccccc4)(c4ccccc4)c4ccccc4)cc3c3cc(P(=O)(c4ccccc4)c4ccccc4)ccc32)cc1 |
| InChI | InChI=1S/C60H45NO2P2Si/c62-64(47-22-8-1-9-23-47,48-24-10-2-11-25-48)51-38-36-46(37-39-51)61-59-42-40-52(65(63,49-26-12-3-13-27-49)50-28-14-4-15-29-50)44-57(59)58-45-56(41-43-60(58)61)66(53-30-16-5-17-31-53,54-32-18-6-19-33-54)55-34-20-7-21-35-55/h1-45H |
| InChIKey | JJPCMFSQCJVWQT-UHFFFAOYSA-N |
| XLogP | 9.44 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 902.06 |
| LogP ≤ 5 | 9.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|