C54H39NO2P2S — CID 87159597
3-diphenylphosphoryl-9-(4-diphenylphosphorylphenyl)-6-(4-phenylphenyl)sulfanylcarbazole (PubChem CID 87159597) has the molecular formula C54H39NO2P2S and a molecular weight of 827.93 g/mol. Its IUPAC name is 3-diphenylphosphoryl-9-(4-diphenylphosphorylphenyl)-6-(4-phenylphenyl)sulfanylcarbazole.
| Compound Name | 3-diphenylphosphoryl-9-(4-diphenylphosphorylphenyl)-6-(4-phenylphenyl)sulfanylcarbazole |
|---|---|
| PubChem CID | 87159597 |
| Molecular Formula | C54H39NO2P2S |
| Molecular Weight | 827.93 g/mol |
| Exact Mass | 827.22 |
| IUPAC Name | 3-diphenylphosphoryl-9-(4-diphenylphosphorylphenyl)-6-(4-phenylphenyl)sulfanylcarbazole |
| SMILES | O=P(c1ccccc1)(c1ccccc1)c1ccc(-n2c3ccc(Sc4ccc(-c5ccccc5)cc4)cc3c3cc(P(=O)(c4ccccc4)c4ccccc4)ccc32)cc1 |
| InChI | InChI=1S/C54H39NO2P2S/c56-58(43-18-8-2-9-19-43,44-20-10-3-11-21-44)47-30-28-42(29-31-47)55-53-36-32-48(59(57,45-22-12-4-13-23-45)46-24-14-5-15-25-46)38-51(53)52-39-50(35-37-54(52)55)60-49-33-26-41(27-34-49)40-16-6-1-7-17-40/h1-39H |
| InChIKey | NIMXKNAUEUCOOV-UHFFFAOYSA-N |
| XLogP | 11.88 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 827.93 |
| LogP ≤ 5 | 11.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|