C63H51NO2P2Si — CID 87159620
[6-diphenylphosphoryl-9-(4-diphenylphosphorylphenyl)carbazol-3-yl]-tris(4-methylphenyl)silane (PubChem CID 87159620) has the molecular formula C63H51NO2P2Si and a molecular weight of 944.14 g/mol. Its IUPAC name is [6-diphenylphosphoryl-9-(4-diphenylphosphorylphenyl)carbazol-3-yl]-tris(4-methylphenyl)silane.
| Compound Name | [6-diphenylphosphoryl-9-(4-diphenylphosphorylphenyl)carbazol-3-yl]-tris(4-methylphenyl)silane |
|---|---|
| PubChem CID | 87159620 |
| Molecular Formula | C63H51NO2P2Si |
| Molecular Weight | 944.14 g/mol |
| Exact Mass | 943.32 |
| IUPAC Name | [6-diphenylphosphoryl-9-(4-diphenylphosphorylphenyl)carbazol-3-yl]-tris(4-methylphenyl)silane |
| SMILES | Cc1ccc([Si](c2ccc(C)cc2)(c2ccc(C)cc2)c2ccc3c(c2)c2cc(P(=O)(c4ccccc4)c4ccccc4)ccc2n3-c2ccc(P(=O)(c3ccccc3)c3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C63H51NO2P2Si/c1-46-24-35-56(36-25-46)69(57-37-26-47(2)27-38-57,58-39-28-48(3)29-40-58)59-41-43-63-61(45-59)60-44-55(68(66,52-20-12-6-13-21-52)53-22-14-7-15-23-53)34-42-62(60)64(63)49-30-32-54(33-31-49)67(65,50-16-8-4-9-17-50)51-18-10-5-11-19-51/h4-45H,1-3H3 |
| InChIKey | SFWQCLXPNBXBTL-UHFFFAOYSA-N |
| XLogP | 10.37 |
| TPSA | 39.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 944.14 |
| LogP ≤ 5 | 10.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|