C62H50NO3P3 — CID 87159603
3-[(6-tert-butylnaphthalen-2-yl)-phenylphosphoryl]-6-diphenylphosphoryl-9-(4-diphenylphosphorylphenyl)carbazole (PubChem CID 87159603) has the molecular formula C62H50NO3P3 and a molecular weight of 950.01 g/mol. Its IUPAC name is 3-[(6-tert-butylnaphthalen-2-yl)-phenylphosphoryl]-6-diphenylphosphoryl-9-(4-diphenylphosphorylphenyl)carbazole.
| Compound Name | 3-[(6-tert-butylnaphthalen-2-yl)-phenylphosphoryl]-6-diphenylphosphoryl-9-(4-diphenylphosphorylphenyl)carbazole |
|---|---|
| PubChem CID | 87159603 |
| Molecular Formula | C62H50NO3P3 |
| Molecular Weight | 950.01 g/mol |
| Exact Mass | 949.30 |
| IUPAC Name | 3-[(6-tert-butylnaphthalen-2-yl)-phenylphosphoryl]-6-diphenylphosphoryl-9-(4-diphenylphosphorylphenyl)carbazole |
| SMILES | CC(C)(C)c1ccc2cc(P(=O)(c3ccccc3)c3ccc4c(c3)c3cc(P(=O)(c5ccccc5)c5ccccc5)ccc3n4-c3ccc(P(=O)(c4ccccc4)c4ccccc4)cc3)ccc2c1 |
| InChI | InChI=1S/C62H50NO3P3/c1-62(2,3)47-31-29-46-42-55(34-30-45(46)41-47)69(66,53-27-17-8-18-28-53)57-38-40-61-59(44-57)58-43-56(68(65,51-23-13-6-14-24-51)52-25-15-7-16-26-52)37-39-60(58)63(61)48-32-35-54(36-33-48)67(64,49-19-9-4-10-20-49)50-21-11-5-12-22-50/h4-44H,1-3H3 |
| InChIKey | XYHASWRMMITXQU-UHFFFAOYSA-N |
| XLogP | 12.15 |
| TPSA | 56.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 69 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 950.01 |
| LogP ≤ 5 | 12.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|