C50H39FN2Si — CID 59720504
9-(4-fluorophenyl)-N,N-bis(4-methylphenyl)-6-triphenylsilylcarbazol-3-amine (PubChem CID 59720504) has the molecular formula C50H39FN2Si and a molecular weight of 714.96 g/mol. Its IUPAC name is 9-(4-fluorophenyl)-N,N-bis(4-methylphenyl)-6-triphenylsilylcarbazol-3-amine.
| Compound Name | 9-(4-fluorophenyl)-N,N-bis(4-methylphenyl)-6-triphenylsilylcarbazol-3-amine |
|---|---|
| PubChem CID | 59720504 |
| Molecular Formula | C50H39FN2Si |
| Molecular Weight | 714.96 g/mol |
| Exact Mass | 714.29 |
| IUPAC Name | 9-(4-fluorophenyl)-N,N-bis(4-methylphenyl)-6-triphenylsilylcarbazol-3-amine |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc3c(c2)c2cc([Si](c4ccccc4)(c4ccccc4)c4ccccc4)ccc2n3-c2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C50H39FN2Si/c1-36-18-24-39(25-19-36)52(40-26-20-37(2)21-27-40)42-30-32-49-47(34-42)48-35-46(31-33-50(48)53(49)41-28-22-38(51)23-29-41)54(43-12-6-3-7-13-43,44-14-8-4-9-15-44)45-16-10-5-11-17-45/h3-35H,1-2H3 |
| InChIKey | DDQJACIDISHQQM-UHFFFAOYSA-N |
| XLogP | 10.39 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.96 |
| LogP ≤ 5 | 10.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|