C74H44N10 — CID 140745591
5-[2-cyano-5-(4-cyanophenyl)-3-(6-isocyano-3-pyridinyl)-4,6-bis[3-(N-phenylanilino)carbazol-9-yl]phenyl]pyridine-2-carbonitrile (PubChem CID 140745591) has the molecular formula C74H44N10 and a molecular weight of 1073.24 g/mol. Its IUPAC name is 5-[2-cyano-5-(4-cyanophenyl)-3-(6-isocyano-3-pyridinyl)-4,6-bis[3-(N-phenylanilino)carbazol-9-yl]phenyl]pyridine-2-carbonitrile.
| Compound Name | 5-[2-cyano-5-(4-cyanophenyl)-3-(6-isocyano-3-pyridinyl)-4,6-bis[3-(N-phenylanilino)carbazol-9-yl]phenyl]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 140745591 |
| Molecular Formula | C74H44N10 |
| Molecular Weight | 1073.24 g/mol |
| Exact Mass | 1072.38 |
| IUPAC Name | 5-[2-cyano-5-(4-cyanophenyl)-3-(6-isocyano-3-pyridinyl)-4,6-bis[3-(N-phenylanilino)carbazol-9-yl]phenyl]pyridine-2-carbonitrile |
| SMILES | [C-]#[N+]c1ccc(-c2c(C#N)c(-c3ccc(C#N)nc3)c(-n3c4ccccc4c4cc(N(c5ccccc5)c5ccccc5)ccc43)c(-c3ccc(C#N)cc3)c2-n2c3ccccc3c3cc(N(c4ccccc4)c4ccccc4)ccc32)cn1 |
| InChI | InChI=1S/C74H44N10/c1-78-69-41-35-52(48-80-69)71-64(46-77)70(51-34-36-53(45-76)79-47-51)73(83-65-28-16-14-26-60(65)62-42-58(37-39-67(62)83)81(54-18-6-2-7-19-54)55-20-8-3-9-21-55)72(50-32-30-49(44-75)31-33-50)74(71)84-66-29-17-15-27-61(66)63-43-59(38-40-68(63)84)82(56-22-10-4-11-23-56)57-24-12-5-13-25-57/h2-43,47-48H |
| InChIKey | JGGYASCDBUZGIT-UHFFFAOYSA-N |
| XLogP | 18.78 |
| TPSA | 117.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 84 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1073.24 |
| LogP ≤ 5 | 18.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|