C8H8N2O — CID 166796847
3-ethynyl-1-hydroxy-5,6-dihydro-4H-cyclopenta[d]pyrazole (PubChem CID 166796847) has the molecular formula C8H8N2O and a molecular weight of 148.16 g/mol. Its IUPAC name is 3-ethynyl-1-hydroxy-5,6-dihydro-4H-cyclopenta[d]pyrazole.
| Compound Name | 3-ethynyl-1-hydroxy-5,6-dihydro-4H-cyclopenta[d]pyrazole |
|---|---|
| PubChem CID | 166796847 |
| Molecular Formula | C8H8N2O |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | 3-ethynyl-1-hydroxy-5,6-dihydro-4H-cyclopenta[d]pyrazole |
| SMILES | C#Cc1nn(O)c2c1CCC2 |
| InChI | InChI=1S/C8H8N2O/c1-2-7-6-4-3-5-8(6)10(11)9-7/h1,11H,3-5H2 |
| InChIKey | HHGPJGGCBZROAP-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|