C8H12N2O3S — CID 166796743
1-hydroxy-3-methylsulfonyl-4,5,6,7-tetrahydroindazole (PubChem CID 166796743) has the molecular formula C8H12N2O3S and a molecular weight of 216.26 g/mol. Its IUPAC name is 1-hydroxy-3-methylsulfonyl-4,5,6,7-tetrahydroindazole.
| Compound Name | 1-hydroxy-3-methylsulfonyl-4,5,6,7-tetrahydroindazole |
|---|---|
| PubChem CID | 166796743 |
| Molecular Formula | C8H12N2O3S |
| Molecular Weight | 216.26 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | 1-hydroxy-3-methylsulfonyl-4,5,6,7-tetrahydroindazole |
| SMILES | CS(=O)(=O)c1nn(O)c2c1CCCC2 |
| InChI | InChI=1S/C8H12N2O3S/c1-14(12,13)8-6-4-2-3-5-7(6)10(11)9-8/h11H,2-5H2,1H3 |
| InChIKey | QZJGCFKJMTVJKU-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.26 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'N-hydroxyl_pyridine', 'substructure': 'N/A'} |
|---|