C11H13NO — CID 122480718
3,5,6,7-tetrahydro-2H-cyclopenta[f][1]benzofuran-4-amine (PubChem CID 122480718) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is 3,5,6,7-tetrahydro-2H-cyclopenta[f][1]benzofuran-4-amine.
| Compound Name | 3,5,6,7-tetrahydro-2H-cyclopenta[f][1]benzofuran-4-amine |
|---|---|
| PubChem CID | 122480718 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 3,5,6,7-tetrahydro-2H-cyclopenta[f][1]benzofuran-4-amine |
| SMILES | Nc1c2c(cc3c1CCO3)CCC2 |
| InChI | InChI=1S/C11H13NO/c12-11-8-3-1-2-7(8)6-10-9(11)4-5-13-10/h6H,1-5,12H2 |
| InChIKey | WMVHXVXNSHZQIE-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|