C12H14O2S — CID 116986422
2,3,4,7,8,9-hexahydropyrano[2,3-g]chromene-5-thiol (PubChem CID 116986422) has the molecular formula C12H14O2S and a molecular weight of 222.31 g/mol. Its IUPAC name is 2,3,4,7,8,9-hexahydropyrano[2,3-g]chromene-5-thiol.
| Compound Name | 2,3,4,7,8,9-hexahydropyrano[2,3-g]chromene-5-thiol |
|---|---|
| PubChem CID | 116986422 |
| Molecular Formula | C12H14O2S |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 2,3,4,7,8,9-hexahydropyrano[2,3-g]chromene-5-thiol |
| SMILES | Sc1c2c(cc3c1OCCC3)OCCC2 |
| InChI | InChI=1S/C12H14O2S/c15-12-9-4-2-5-13-10(9)7-8-3-1-6-14-11(8)12/h7,15H,1-6H2 |
| InChIKey | YFHJDIRORRJMSU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|