C15H21NO2 — CID 115010139
1-(2,3,4,7,8,9-hexahydropyrano[2,3-g]chromen-5-yl)-N-methylethanamine (PubChem CID 115010139) has the molecular formula C15H21NO2 and a molecular weight of 247.34 g/mol. Its IUPAC name is 1-(2,3,4,7,8,9-hexahydropyrano[2,3-g]chromen-5-yl)-N-methylethanamine.
| Compound Name | 1-(2,3,4,7,8,9-hexahydropyrano[2,3-g]chromen-5-yl)-N-methylethanamine |
|---|---|
| PubChem CID | 115010139 |
| Molecular Formula | C15H21NO2 |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.16 |
| IUPAC Name | 1-(2,3,4,7,8,9-hexahydropyrano[2,3-g]chromen-5-yl)-N-methylethanamine |
| SMILES | CNC(C)c1c2c(cc3c1OCCC3)OCCC2 |
| InChI | InChI=1S/C15H21NO2/c1-10(16-2)14-12-6-4-7-17-13(12)9-11-5-3-8-18-15(11)14/h9-10,16H,3-8H2,1-2H3 |
| InChIKey | ZYUJETOUOISQPE-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |