C15H18O4 — CID 116986424
methyl 2-(2,3,4,7,8,9-hexahydropyrano[2,3-g]chromen-5-yl)acetate (PubChem CID 116986424) has the molecular formula C15H18O4 and a molecular weight of 262.30 g/mol. Its IUPAC name is methyl 2-(2,3,4,7,8,9-hexahydropyrano[2,3-g]chromen-5-yl)acetate.
| Compound Name | methyl 2-(2,3,4,7,8,9-hexahydropyrano[2,3-g]chromen-5-yl)acetate |
|---|---|
| PubChem CID | 116986424 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | methyl 2-(2,3,4,7,8,9-hexahydropyrano[2,3-g]chromen-5-yl)acetate |
| SMILES | COC(=O)Cc1c2c(cc3c1OCCC3)OCCC2 |
| InChI | InChI=1S/C15H18O4/c1-17-14(16)9-12-11-5-3-6-18-13(11)8-10-4-2-7-19-15(10)12/h8H,2-7,9H2,1H3 |
| InChIKey | YFNQWHSOJHZNOA-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |