C18H25NO2 — CID 117464038
1-(2,3,4,7,8,9-hexahydropyrano[2,3-g]chromen-5-yl)cyclohexan-1-amine (PubChem CID 117464038) has the molecular formula C18H25NO2 and a molecular weight of 287.40 g/mol. Its IUPAC name is 1-(2,3,4,7,8,9-hexahydropyrano[2,3-g]chromen-5-yl)cyclohexan-1-amine.
| Compound Name | 1-(2,3,4,7,8,9-hexahydropyrano[2,3-g]chromen-5-yl)cyclohexan-1-amine |
|---|---|
| PubChem CID | 117464038 |
| Molecular Formula | C18H25NO2 |
| Molecular Weight | 287.40 g/mol |
| Exact Mass | 287.19 |
| IUPAC Name | 1-(2,3,4,7,8,9-hexahydropyrano[2,3-g]chromen-5-yl)cyclohexan-1-amine |
| SMILES | NC1(c2c3c(cc4c2OCCC4)OCCC3)CCCCC1 |
| InChI | InChI=1S/C18H25NO2/c19-18(8-2-1-3-9-18)16-14-7-5-10-20-15(14)12-13-6-4-11-21-17(13)16/h12H,1-11,19H2 |
| InChIKey | PVEWXVGRXBJWGL-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |