C17H23NO3 — CID 117467561
10-(1-aminocyclopentyl)-2,3,4,7,8,9-hexahydropyrano[2,3-g]chromen-5-ol (PubChem CID 117467561) has the molecular formula C17H23NO3 and a molecular weight of 289.38 g/mol. Its IUPAC name is 10-(1-aminocyclopentyl)-2,3,4,7,8,9-hexahydropyrano[2,3-g]chromen-5-ol.
| Compound Name | 10-(1-aminocyclopentyl)-2,3,4,7,8,9-hexahydropyrano[2,3-g]chromen-5-ol |
|---|---|
| PubChem CID | 117467561 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | 10-(1-aminocyclopentyl)-2,3,4,7,8,9-hexahydropyrano[2,3-g]chromen-5-ol |
| SMILES | NC1(c2c3c(c(O)c4c2OCCC4)OCCC3)CCCC1 |
| InChI | InChI=1S/C17H23NO3/c18-17(7-1-2-8-17)13-11-5-3-10-21-16(11)14(19)12-6-4-9-20-15(12)13/h19H,1-10,18H2 |
| InChIKey | BWRQJJMXQBPQIY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 64.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |