C14H15NO4 — CID 117406838
10-(isocyanatomethyl)-2,3,4,7,8,9-hexahydropyrano[2,3-g]chromen-5-ol (PubChem CID 117406838) has the molecular formula C14H15NO4 and a molecular weight of 261.28 g/mol. Its IUPAC name is 10-(isocyanatomethyl)-2,3,4,7,8,9-hexahydropyrano[2,3-g]chromen-5-ol.
| Compound Name | 10-(isocyanatomethyl)-2,3,4,7,8,9-hexahydropyrano[2,3-g]chromen-5-ol |
|---|---|
| PubChem CID | 117406838 |
| Molecular Formula | C14H15NO4 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | 10-(isocyanatomethyl)-2,3,4,7,8,9-hexahydropyrano[2,3-g]chromen-5-ol |
| SMILES | O=C=NCc1c2c(c(O)c3c1OCCC3)OCCC2 |
| InChI | InChI=1S/C14H15NO4/c16-8-15-7-11-9-3-1-6-19-14(9)12(17)10-4-2-5-18-13(10)11/h17H,1-7H2 |
| InChIKey | SASRTQSYWLWBGN-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 68.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|