C14H17NO5 — CID 117447616
2-amino-2-(5-hydroxy-2,3,4,7,8,9-hexahydropyrano[2,3-g]chromen-10-yl)acetic acid (PubChem CID 117447616) has the molecular formula C14H17NO5 and a molecular weight of 279.29 g/mol. Its IUPAC name is 2-amino-2-(5-hydroxy-2,3,4,7,8,9-hexahydropyrano[2,3-g]chromen-10-yl)acetic acid.
| Compound Name | 2-amino-2-(5-hydroxy-2,3,4,7,8,9-hexahydropyrano[2,3-g]chromen-10-yl)acetic acid |
|---|---|
| PubChem CID | 117447616 |
| Molecular Formula | C14H17NO5 |
| Molecular Weight | 279.29 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 2-amino-2-(5-hydroxy-2,3,4,7,8,9-hexahydropyrano[2,3-g]chromen-10-yl)acetic acid |
| SMILES | NC(C(=O)O)c1c2c(c(O)c3c1OCCC3)OCCC2 |
| InChI | InChI=1S/C14H17NO5/c15-10(14(17)18)9-7-3-1-6-20-13(7)11(16)8-4-2-5-19-12(8)9/h10,16H,1-6,15H2,(H,17,18) |
| InChIKey | YDQWITDLPVRVOC-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.29 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |